About 4-butylbenzoic acid;zinc
4-butylbenzoic acid;zinc (PubChem CID 175174767) has the molecular formula C11H14O2Zn
and a molecular weight of 243.62 g/mol. Its IUPAC name is 4-butylbenzoic acid;zinc.
Molecular Properties
| Compound Name | 4-butylbenzoic acid;zinc |
| PubChem CID | 175174767 |
| Molecular Formula | C11H14O2Zn |
| Molecular Weight | 243.62 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 4-butylbenzoic acid;zinc |
| SMILES | CCCCc1ccc(C(=O)O)cc1.[Zn] |
| InChI | InChI=1S/C11H14O2.Zn/c1-2-3-4-9-5-7-10(8-6-9)11(12)13;/h5-8H,2-4H2,1H3,(H,12,13); |
| InChIKey | IPNNWWOXBRGKAM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-butylbenzoic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylbenzoic acid;zinc?
The IUPAC name of 4-butylbenzoic acid;zinc (CID 175174767) is 4-butylbenzoic acid;zinc.
What is the SMILES notation for 4-butylbenzoic acid;zinc?
The canonical SMILES for 4-butylbenzoic acid;zinc is CCCCc1ccc(C(=O)O)cc1.[Zn].
What is the InChIKey of 4-butylbenzoic acid;zinc?
The InChIKey is IPNNWWOXBRGKAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.Zn/c1-2-3-4-9-5-7-10(8-6-9)11(12)13;/h5-8H,2-4H2,1H3,(H,12,13);.
What are the key properties of 4-butylbenzoic acid;zinc?
4-butylbenzoic acid;zinc has a molecular weight of 243.62 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylbenzoic acid;zinc is sourced from PubChem (CID 175174767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).