About cadmium(2+);bis(4-propylbenzoate)
cadmium(2+);bis(4-propylbenzoate) (PubChem CID 101299923) has the molecular formula C20H22CdO4
and a molecular weight of 438.80 g/mol. Its IUPAC name is cadmium(2+);bis(4-propylbenzoate).
Molecular Properties
| Compound Name | cadmium(2+);bis(4-propylbenzoate) |
| PubChem CID | 101299923 |
| Molecular Formula | C20H22CdO4 |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | cadmium(2+);bis(4-propylbenzoate) |
| SMILES | CCCc1ccc(C(=O)[O-])cc1.CCCc1ccc(C(=O)[O-])cc1.[Cd+2] |
| InChI | InChI=1S/2C10H12O2.Cd/c2*1-2-3-8-4-6-9(7-5-8)10(11)12;/h2*4-7H,2-3H2,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | FPVVWZHNQUFHST-UHFFFAOYSA-L |
| XLogP | 2.00 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cadmium(2+);bis(4-propylbenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(4-propylbenzoate)?
The IUPAC name of cadmium(2+);bis(4-propylbenzoate) (CID 101299923) is cadmium(2+);bis(4-propylbenzoate).
What is the SMILES notation for cadmium(2+);bis(4-propylbenzoate)?
The canonical SMILES for cadmium(2+);bis(4-propylbenzoate) is CCCc1ccc(C(=O)[O-])cc1.CCCc1ccc(C(=O)[O-])cc1.[Cd+2].
What is the InChIKey of cadmium(2+);bis(4-propylbenzoate)?
The InChIKey is FPVVWZHNQUFHST-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H12O2.Cd/c2*1-2-3-8-4-6-9(7-5-8)10(11)12;/h2*4-7H,2-3H2,1H3,(H,11,12);/q;;+2/p-2.
What are the key properties of cadmium(2+);bis(4-propylbenzoate)?
cadmium(2+);bis(4-propylbenzoate) has a molecular weight of 438.80 g/mol, XLogP of 2.00, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(4-propylbenzoate) is sourced from PubChem (CID 101299923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).