C25H29F — CID 134174223
1-butyl-4-[(3Z,5E)-7-(4-ethylphenyl)-5-fluorohepta-1,3,5-trien-4-yl]benzene (PubChem CID 134174223) has the molecular formula C25H29F and a molecular weight of 348.51 g/mol. Its IUPAC name is 1-butyl-4-[(3Z,5E)-7-(4-ethylphenyl)-5-fluorohepta-1,3,5-trien-4-yl]benzene.
| Compound Name | 1-butyl-4-[(3Z,5E)-7-(4-ethylphenyl)-5-fluorohepta-1,3,5-trien-4-yl]benzene |
|---|---|
| PubChem CID | 134174223 |
| Molecular Formula | C25H29F |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 1-butyl-4-[(3Z,5E)-7-(4-ethylphenyl)-5-fluorohepta-1,3,5-trien-4-yl]benzene |
| SMILES | C=C/C=C(C(\F)=C/Cc1ccc(CC)cc1)/c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C25H29F/c1-4-7-9-21-14-17-23(18-15-21)24(8-5-2)25(26)19-16-22-12-10-20(6-3)11-13-22/h5,8,10-15,17-19H,2,4,6-7,9,16H2,1,3H3/b24-8-,25-19+ |
| InChIKey | QALGVYGWZAOPQR-XKMXKTNISA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|