C25H27F — CID 131995446
1-butyl-4-[(2E,4E)-4-(4-ethylphenyl)-2-fluorohepta-2,4-dien-6-ynyl]benzene (PubChem CID 131995446) has the molecular formula C25H27F and a molecular weight of 346.49 g/mol. Its IUPAC name is 1-butyl-4-[(2E,4E)-4-(4-ethylphenyl)-2-fluorohepta-2,4-dien-6-ynyl]benzene.
| Compound Name | 1-butyl-4-[(2E,4E)-4-(4-ethylphenyl)-2-fluorohepta-2,4-dien-6-ynyl]benzene |
|---|---|
| PubChem CID | 131995446 |
| Molecular Formula | C25H27F |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-butyl-4-[(2E,4E)-4-(4-ethylphenyl)-2-fluorohepta-2,4-dien-6-ynyl]benzene |
| SMILES | C#C/C=C(\C=C(\F)Cc1ccc(CCCC)cc1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C25H27F/c1-4-7-9-21-10-12-22(13-11-21)18-25(26)19-24(8-5-2)23-16-14-20(6-3)15-17-23/h2,8,10-17,19H,4,6-7,9,18H2,1,3H3/b24-8+,25-19+ |
| InChIKey | SLBAGJXYVDQDDJ-GZNHOLKUSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|