C26H26F2 — CID 54128812
1-[3,4-difluoro-6-(4-pentylphenyl)hex-3-en-1,5-diynyl]-4-propylbenzene (PubChem CID 54128812) has the molecular formula C26H26F2 and a molecular weight of 376.49 g/mol. Its IUPAC name is 1-[3,4-difluoro-6-(4-pentylphenyl)hex-3-en-1,5-diynyl]-4-propylbenzene.
| Compound Name | 1-[3,4-difluoro-6-(4-pentylphenyl)hex-3-en-1,5-diynyl]-4-propylbenzene |
|---|---|
| PubChem CID | 54128812 |
| Molecular Formula | C26H26F2 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-[3,4-difluoro-6-(4-pentylphenyl)hex-3-en-1,5-diynyl]-4-propylbenzene |
| SMILES | CCCCCc1ccc(C#CC(F)=C(F)C#Cc2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C26H26F2/c1-3-5-6-8-22-11-15-24(16-12-22)18-20-26(28)25(27)19-17-23-13-9-21(7-4-2)10-14-23/h9-16H,3-8H2,1-2H3 |
| InChIKey | NSVSRUPJLMAUPL-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|