About 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene
1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene (PubChem CID 54055732) has the molecular formula C30H34F2
and a molecular weight of 432.60 g/mol. Its IUPAC name is 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene.
Molecular Properties
| Compound Name | 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene |
| PubChem CID | 54055732 |
| Molecular Formula | C30H34F2 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene |
| SMILES | CCCCCCc1ccc(C#CC(F)=C(F)C#Cc2ccc(CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C30H34F2/c1-3-5-7-9-11-25-13-17-27(18-14-25)21-23-29(31)30(32)24-22-28-19-15-26(16-20-28)12-10-8-6-4-2/h13-20H,3-12H2,1-2H3 |
| InChIKey | LWCNIZGCSAPWSH-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene?
The IUPAC name of 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene (CID 54055732) is 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene.
What is the SMILES notation for 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene?
The canonical SMILES for 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene is CCCCCCc1ccc(C#CC(F)=C(F)C#Cc2ccc(CCCCCC)cc2)cc1.
What is the InChIKey of 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene?
The InChIKey is LWCNIZGCSAPWSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H34F2/c1-3-5-7-9-11-25-13-17-27(18-14-25)21-23-29(31)30(32)24-22-28-19-15-26(16-20-28)12-10-8-6-4-2/h13-20H,3-12H2,1-2H3.
What are the key properties of 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene?
1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene has a molecular weight of 432.60 g/mol, XLogP of 8.49, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,4-difluoro-6-(4-hexylphenyl)hex-3-en-1,5-diynyl]-4-hexylbenzene is sourced from PubChem (CID 54055732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).