C22H22 — CID 14573547
1-propyl-4-[4-(4-propylphenyl)buta-1,3-diynyl]benzene (PubChem CID 14573547) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-propyl-4-[4-(4-propylphenyl)buta-1,3-diynyl]benzene.
| Compound Name | 1-propyl-4-[4-(4-propylphenyl)buta-1,3-diynyl]benzene |
|---|---|
| PubChem CID | 14573547 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-propyl-4-[4-(4-propylphenyl)buta-1,3-diynyl]benzene |
| SMILES | CCCc1ccc(C#CC#Cc2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C22H22/c1-3-7-19-11-15-21(16-12-19)9-5-6-10-22-17-13-20(8-4-2)14-18-22/h11-18H,3-4,7-8H2,1-2H3 |
| InChIKey | JYXYTGOPDGIWDH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|