C19H26Si — CID 12032946
4-(4-hexylphenyl)buta-1,3-diynyl-trimethylsilane (PubChem CID 12032946) has the molecular formula C19H26Si and a molecular weight of 282.50 g/mol. Its IUPAC name is 4-(4-hexylphenyl)buta-1,3-diynyl-trimethylsilane.
| Compound Name | 4-(4-hexylphenyl)buta-1,3-diynyl-trimethylsilane |
|---|---|
| PubChem CID | 12032946 |
| Molecular Formula | C19H26Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-(4-hexylphenyl)buta-1,3-diynyl-trimethylsilane |
| SMILES | CCCCCCc1ccc(C#CC#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C19H26Si/c1-5-6-7-8-11-18-13-15-19(16-14-18)12-9-10-17-20(2,3)4/h13-16H,5-8,11H2,1-4H3 |
| InChIKey | KTFCNFRWEDHBKC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|