C17H22OSi — CID 10912597
4-(4-butoxyphenyl)buta-1,3-diynyl-trimethylsilane (PubChem CID 10912597) has the molecular formula C17H22OSi and a molecular weight of 270.45 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)buta-1,3-diynyl-trimethylsilane.
| Compound Name | 4-(4-butoxyphenyl)buta-1,3-diynyl-trimethylsilane |
|---|---|
| PubChem CID | 10912597 |
| Molecular Formula | C17H22OSi |
| Molecular Weight | 270.45 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-(4-butoxyphenyl)buta-1,3-diynyl-trimethylsilane |
| SMILES | CCCCOc1ccc(C#CC#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C17H22OSi/c1-5-6-14-18-17-12-10-16(11-13-17)9-7-8-15-19(2,3)4/h10-13H,5-6,14H2,1-4H3 |
| InChIKey | HNSDFTSKRVUEKC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|