About 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile
4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile (PubChem CID 132599654) has the molecular formula C18H13NSi
and a molecular weight of 271.40 g/mol. Its IUPAC name is 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile.
Molecular Properties
| Compound Name | 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile |
| PubChem CID | 132599654 |
| Molecular Formula | C18H13NSi |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile |
| SMILES | C[Si](C)(C)C#CC#CC#CC#Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H13NSi/c1-20(2,3)15-9-7-5-4-6-8-10-17-11-13-18(16-19)14-12-17/h11-14H,1-3H3 |
| InChIKey | FPVZZVXQASRURN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile?
The IUPAC name of 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile (CID 132599654) is 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile.
What is the SMILES notation for 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile?
The canonical SMILES for 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile is C[Si](C)(C)C#CC#CC#CC#Cc1ccc(C#N)cc1.
What is the InChIKey of 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile?
The InChIKey is FPVZZVXQASRURN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NSi/c1-20(2,3)15-9-7-5-4-6-8-10-17-11-13-18(16-19)14-12-17/h11-14H,1-3H3.
What are the key properties of 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile?
4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile has a molecular weight of 271.40 g/mol, XLogP of 2.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile is sourced from PubChem (CID 132599654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).