C18H13NSi — CID 132599654
4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile (PubChem CID 132599654) has the molecular formula C18H13NSi and a molecular weight of 271.40 g/mol. Its IUPAC name is 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile.
| Compound Name | 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile |
|---|---|
| PubChem CID | 132599654 |
| Molecular Formula | C18H13NSi |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-(8-trimethylsilylocta-1,3,5,7-tetraynyl)benzonitrile |
| SMILES | C[Si](C)(C)C#CC#CC#CC#Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H13NSi/c1-20(2,3)15-9-7-5-4-6-8-10-17-11-13-18(16-19)14-12-17/h11-14H,1-3H3 |
| InChIKey | FPVZZVXQASRURN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|