C20H13F3Si — CID 102177171
trimethyl-[10-[4-(trifluoromethyl)phenyl]deca-1,3,5,7,9-pentaynyl]silane (PubChem CID 102177171) has the molecular formula C20H13F3Si and a molecular weight of 338.40 g/mol. Its IUPAC name is trimethyl-[10-[4-(trifluoromethyl)phenyl]deca-1,3,5,7,9-pentaynyl]silane.
| Compound Name | trimethyl-[10-[4-(trifluoromethyl)phenyl]deca-1,3,5,7,9-pentaynyl]silane |
|---|---|
| PubChem CID | 102177171 |
| Molecular Formula | C20H13F3Si |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | trimethyl-[10-[4-(trifluoromethyl)phenyl]deca-1,3,5,7,9-pentaynyl]silane |
| SMILES | C[Si](C)(C)C#CC#CC#CC#CC#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H13F3Si/c1-24(2,3)17-11-9-7-5-4-6-8-10-12-18-13-15-19(16-14-18)20(21,22)23/h13-16H,1-3H3 |
| InChIKey | JMQBWNSERHNZOW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|