C9H6F3NO2S — CID 174814107
2-[4-(trifluoromethyl)phenyl]ethynesulfonamide (PubChem CID 174814107) has the molecular formula C9H6F3NO2S and a molecular weight of 249.21 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]ethynesulfonamide.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]ethynesulfonamide |
|---|---|
| PubChem CID | 174814107 |
| Molecular Formula | C9H6F3NO2S |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]ethynesulfonamide |
| SMILES | NS(=O)(=O)C#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H6F3NO2S/c10-9(11,12)8-3-1-7(2-4-8)5-6-16(13,14)15/h1-4H,(H2,13,14,15) |
| InChIKey | GPHVYERDVSWUJA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|