C14H14O2Si — CID 141099093
4-(4-trimethylsilylbuta-1,3-diynyl)benzoic acid (PubChem CID 141099093) has the molecular formula C14H14O2Si and a molecular weight of 242.35 g/mol. Its IUPAC name is 4-(4-trimethylsilylbuta-1,3-diynyl)benzoic acid.
| Compound Name | 4-(4-trimethylsilylbuta-1,3-diynyl)benzoic acid |
|---|---|
| PubChem CID | 141099093 |
| Molecular Formula | C14H14O2Si |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-(4-trimethylsilylbuta-1,3-diynyl)benzoic acid |
| SMILES | C[Si](C)(C)C#CC#Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H14O2Si/c1-17(2,3)11-5-4-6-12-7-9-13(10-8-12)14(15)16/h7-10H,1-3H3,(H,15,16) |
| InChIKey | RMQLXGOEWRILMR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|