C26H14O4 — CID 132539761
6-[4-(6-carboxynaphthalen-2-yl)buta-1,3-diynyl]naphthalene-2-carboxylic acid (PubChem CID 132539761) has the molecular formula C26H14O4 and a molecular weight of 390.39 g/mol. Its IUPAC name is 6-[4-(6-carboxynaphthalen-2-yl)buta-1,3-diynyl]naphthalene-2-carboxylic acid.
| Compound Name | 6-[4-(6-carboxynaphthalen-2-yl)buta-1,3-diynyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 132539761 |
| Molecular Formula | C26H14O4 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 6-[4-(6-carboxynaphthalen-2-yl)buta-1,3-diynyl]naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2cc(C#CC#Cc3ccc4cc(C(=O)O)ccc4c3)ccc2c1 |
| InChI | InChI=1S/C26H14O4/c27-25(28)23-11-9-19-13-17(5-7-21(19)15-23)3-1-2-4-18-6-8-22-16-24(26(29)30)12-10-20(22)14-18/h5-16H,(H,27,28)(H,29,30) |
| InChIKey | PUFJEYUYHUKUHD-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|