C16H14O3 — CID 121005390
6-(3-hydroxy-3-methylbut-1-ynyl)naphthalene-2-carboxylic acid (PubChem CID 121005390) has the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. Its IUPAC name is 6-(3-hydroxy-3-methylbut-1-ynyl)naphthalene-2-carboxylic acid.
| Compound Name | 6-(3-hydroxy-3-methylbut-1-ynyl)naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 121005390 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 6-(3-hydroxy-3-methylbut-1-ynyl)naphthalene-2-carboxylic acid |
| SMILES | CC(C)(O)C#Cc1ccc2cc(C(=O)O)ccc2c1 |
| InChI | InChI=1S/C16H14O3/c1-16(2,19)8-7-11-3-4-13-10-14(15(17)18)6-5-12(13)9-11/h3-6,9-10,19H,1-2H3,(H,17,18) |
| InChIKey | LGUXGUIVPCPBHX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|