C13H10N2O — CID 71347287
4-(3-hydroxy-3-methylbut-1-ynyl)benzene-1,2-dicarbonitrile (PubChem CID 71347287) has the molecular formula C13H10N2O and a molecular weight of 210.24 g/mol. Its IUPAC name is 4-(3-hydroxy-3-methylbut-1-ynyl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(3-hydroxy-3-methylbut-1-ynyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 71347287 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 4-(3-hydroxy-3-methylbut-1-ynyl)benzene-1,2-dicarbonitrile |
| SMILES | CC(C)(O)C#Cc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C13H10N2O/c1-13(2,16)6-5-10-3-4-11(8-14)12(7-10)9-15/h3-4,7,16H,1-2H3 |
| InChIKey | JYPVCEFYCVNNJJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|