C12H12O3 — CID 134862576
4-(1,3-benzodioxol-5-yl)-2-methylbut-3-yn-2-ol (PubChem CID 134862576) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-methylbut-3-yn-2-ol.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 134862576 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-methylbut-3-yn-2-ol |
| SMILES | CC(C)(O)C#Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H12O3/c1-12(2,13)6-5-9-3-4-10-11(7-9)15-8-14-10/h3-4,7,13H,8H2,1-2H3 |
| InChIKey | NDJCPZIUTZOELW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|