C17H14O4 — CID 171920415
5-[2-(3,5-dimethoxyphenyl)ethynyl]-1,3-benzodioxole (PubChem CID 171920415) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-[2-(3,5-dimethoxyphenyl)ethynyl]-1,3-benzodioxole.
| Compound Name | 5-[2-(3,5-dimethoxyphenyl)ethynyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 171920415 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-[2-(3,5-dimethoxyphenyl)ethynyl]-1,3-benzodioxole |
| SMILES | COc1cc(C#Cc2ccc3c(c2)OCO3)cc(OC)c1 |
| InChI | InChI=1S/C17H14O4/c1-18-14-7-13(8-15(10-14)19-2)4-3-12-5-6-16-17(9-12)21-11-20-16/h5-10H,11H2,1-2H3 |
| InChIKey | ZNSPQIWPNVXUBR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|