C26H20O5 — CID 170459628
5-[2-[3-[2-(3,4,5-trimethoxyphenyl)ethynyl]phenyl]ethynyl]-1,3-benzodioxole (PubChem CID 170459628) has the molecular formula C26H20O5 and a molecular weight of 412.44 g/mol. Its IUPAC name is 5-[2-[3-[2-(3,4,5-trimethoxyphenyl)ethynyl]phenyl]ethynyl]-1,3-benzodioxole.
| Compound Name | 5-[2-[3-[2-(3,4,5-trimethoxyphenyl)ethynyl]phenyl]ethynyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 170459628 |
| Molecular Formula | C26H20O5 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 5-[2-[3-[2-(3,4,5-trimethoxyphenyl)ethynyl]phenyl]ethynyl]-1,3-benzodioxole |
| SMILES | COc1cc(C#Cc2cccc(C#Cc3ccc4c(c3)OCO4)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H20O5/c1-27-24-15-21(16-25(28-2)26(24)29-3)10-9-19-6-4-5-18(13-19)7-8-20-11-12-22-23(14-20)31-17-30-22/h4-6,11-16H,17H2,1-3H3 |
| InChIKey | VVVDAWIHAIGUMR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|