C17H10O2 — CID 71360276
5-(4-phenylbuta-1,3-diynyl)-1,3-benzodioxole (PubChem CID 71360276) has the molecular formula C17H10O2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 5-(4-phenylbuta-1,3-diynyl)-1,3-benzodioxole.
| Compound Name | 5-(4-phenylbuta-1,3-diynyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 71360276 |
| Molecular Formula | C17H10O2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 5-(4-phenylbuta-1,3-diynyl)-1,3-benzodioxole |
| SMILES | C(C#Cc1ccc2c(c1)OCO2)#Cc1ccccc1 |
| InChI | InChI=1S/C17H10O2/c1-2-6-14(7-3-1)8-4-5-9-15-10-11-16-17(12-15)19-13-18-16/h1-3,6-7,10-12H,13H2 |
| InChIKey | PZJLBBBWSHCBDG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|