C11H8O4 — CID 83700882
4-(1,3-benzodioxol-5-yl)but-3-ynoic acid (PubChem CID 83700882) has the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)but-3-ynoic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)but-3-ynoic acid |
|---|---|
| PubChem CID | 83700882 |
| Molecular Formula | C11H8O4 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)but-3-ynoic acid |
| SMILES | O=C(O)CC#Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H8O4/c12-11(13)3-1-2-8-4-5-9-10(6-8)15-7-14-9/h4-6H,3,7H2,(H,12,13) |
| InChIKey | XJIVVAGYTCSGOF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|