C11H9ClO2 — CID 170467885
5-(4-chlorobut-1-ynyl)-1,3-benzodioxole (PubChem CID 170467885) has the molecular formula C11H9ClO2 and a molecular weight of 208.64 g/mol. Its IUPAC name is 5-(4-chlorobut-1-ynyl)-1,3-benzodioxole.
| Compound Name | 5-(4-chlorobut-1-ynyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 170467885 |
| Molecular Formula | C11H9ClO2 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 5-(4-chlorobut-1-ynyl)-1,3-benzodioxole |
| SMILES | ClCCC#Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H9ClO2/c12-6-2-1-3-9-4-5-10-11(7-9)14-8-13-10/h4-5,7H,2,6,8H2 |
| InChIKey | QVEFDUIPKGKYBY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|