C10H8O3 — CID 11137646
3-(1,3-benzodioxol-5-yl)prop-2-yn-1-ol (PubChem CID 11137646) has the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)prop-2-yn-1-ol.
| Compound Name | 3-(1,3-benzodioxol-5-yl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 11137646 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H8O3/c11-5-1-2-8-3-4-9-10(6-8)13-7-12-9/h3-4,6,11H,5,7H2 |
| InChIKey | IDACMXRFNPOSPL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|