C27H22O6 — CID 170459710
5-[2-[2-[2-(3,4-dimethoxyphenyl)ethynyl]-4,5-dimethoxyphenyl]ethynyl]-1,3-benzodioxole (PubChem CID 170459710) has the molecular formula C27H22O6 and a molecular weight of 442.47 g/mol. Its IUPAC name is 5-[2-[2-[2-(3,4-dimethoxyphenyl)ethynyl]-4,5-dimethoxyphenyl]ethynyl]-1,3-benzodioxole.
| Compound Name | 5-[2-[2-[2-(3,4-dimethoxyphenyl)ethynyl]-4,5-dimethoxyphenyl]ethynyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 170459710 |
| Molecular Formula | C27H22O6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 5-[2-[2-[2-(3,4-dimethoxyphenyl)ethynyl]-4,5-dimethoxyphenyl]ethynyl]-1,3-benzodioxole |
| SMILES | COc1ccc(C#Cc2cc(OC)c(OC)cc2C#Cc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C27H22O6/c1-28-22-11-7-18(13-24(22)29-2)5-9-20-15-25(30-3)26(31-4)16-21(20)10-6-19-8-12-23-27(14-19)33-17-32-23/h7-8,11-16H,17H2,1-4H3 |
| InChIKey | VOAUNODMXCQAFM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|