C32H22N2O5 — CID 171920244
2-[2-(1,3-benzodioxol-5-yl)ethynyl]-9-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,10-phenanthroline (PubChem CID 171920244) has the molecular formula C32H22N2O5 and a molecular weight of 514.54 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethynyl]-9-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,10-phenanthroline.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethynyl]-9-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 171920244 |
| Molecular Formula | C32H22N2O5 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethynyl]-9-[2-(3,4,5-trimethoxyphenyl)ethynyl]-1,10-phenanthroline |
| SMILES | COc1cc(C#Cc2ccc3ccc4ccc(C#Cc5ccc6c(c5)OCO6)nc4c3n2)cc(OC)c1OC |
| InChI | InChI=1S/C32H22N2O5/c1-35-28-17-21(18-29(36-2)32(28)37-3)5-12-25-14-10-23-8-7-22-9-13-24(33-30(22)31(23)34-25)11-4-20-6-15-26-27(16-20)39-19-38-26/h6-10,13-18H,19H2,1-3H3 |
| InChIKey | YHBQJZFMYPRDIX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|