C20H20O5 — CID 145159918
5-[(3E)-4-(3,4,5-trimethoxyphenyl)buta-1,3-dien-2-yl]-1,3-benzodioxole (PubChem CID 145159918) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-[(3E)-4-(3,4,5-trimethoxyphenyl)buta-1,3-dien-2-yl]-1,3-benzodioxole.
| Compound Name | 5-[(3E)-4-(3,4,5-trimethoxyphenyl)buta-1,3-dien-2-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 145159918 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-[(3E)-4-(3,4,5-trimethoxyphenyl)buta-1,3-dien-2-yl]-1,3-benzodioxole |
| SMILES | C=C(/C=C/c1cc(OC)c(OC)c(OC)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20O5/c1-13(15-7-8-16-17(11-15)25-12-24-16)5-6-14-9-18(21-2)20(23-4)19(10-14)22-3/h5-11H,1,12H2,2-4H3/b6-5+ |
| InChIKey | XCAGJQJOLJZASN-AATRIKPKSA-N |
| XLogP | 4.17 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|