C20H17NO6 — CID 177458470
(Z)-4-(1,3-benzodioxol-5-yl)-4-oxo-2-(3,4,5-trimethoxyphenyl)but-2-enenitrile (PubChem CID 177458470) has the molecular formula C20H17NO6 and a molecular weight of 367.36 g/mol. Its IUPAC name is (Z)-4-(1,3-benzodioxol-5-yl)-4-oxo-2-(3,4,5-trimethoxyphenyl)but-2-enenitrile.
| Compound Name | (Z)-4-(1,3-benzodioxol-5-yl)-4-oxo-2-(3,4,5-trimethoxyphenyl)but-2-enenitrile |
|---|---|
| PubChem CID | 177458470 |
| Molecular Formula | C20H17NO6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (Z)-4-(1,3-benzodioxol-5-yl)-4-oxo-2-(3,4,5-trimethoxyphenyl)but-2-enenitrile |
| SMILES | COc1cc(/C(C#N)=C/C(=O)c2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C20H17NO6/c1-23-18-8-13(9-19(24-2)20(18)25-3)14(10-21)6-15(22)12-4-5-16-17(7-12)27-11-26-16/h4-9H,11H2,1-3H3/b14-6+ |
| InChIKey | GFEOXXFKMYRVGX-MKMNVTDBSA-N |
| XLogP | 3.23 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_E(1)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|