C18H15ClO6 — CID 8766247
1,3-benzodioxol-5-yl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 8766247) has the molecular formula C18H15ClO6 and a molecular weight of 362.77 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | 1,3-benzodioxol-5-yl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8766247 |
| Molecular Formula | C18H15ClO6 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 1,3-benzodioxol-5-yl (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc3c(c2)OCO3)cc(Cl)c1OC |
| InChI | InChI=1S/C18H15ClO6/c1-21-16-8-11(7-13(19)18(16)22-2)3-6-17(20)25-12-4-5-14-15(9-12)24-10-23-14/h3-9H,10H2,1-2H3/b6-3+ |
| InChIKey | IMDCFUHBOWYDMJ-ZZXKWVIFSA-N |
| XLogP | 3.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|