C19H19NO7S — CID 8766374
1,3-benzodioxol-5-yl (E)-3-[3-(dimethylsulfamoyl)-4-methoxyphenyl]prop-2-enoate (PubChem CID 8766374) has the molecular formula C19H19NO7S and a molecular weight of 405.43 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl (E)-3-[3-(dimethylsulfamoyl)-4-methoxyphenyl]prop-2-enoate.
| Compound Name | 1,3-benzodioxol-5-yl (E)-3-[3-(dimethylsulfamoyl)-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8766374 |
| Molecular Formula | C19H19NO7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1,3-benzodioxol-5-yl (E)-3-[3-(dimethylsulfamoyl)-4-methoxyphenyl]prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc3c(c2)OCO3)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H19NO7S/c1-20(2)28(22,23)18-10-13(4-7-16(18)24-3)5-9-19(21)27-14-6-8-15-17(11-14)26-12-25-15/h4-11H,12H2,1-3H3/b9-5+ |
| InChIKey | REYLDILXJPAQTR-WEVVVXLNSA-N |
| XLogP | 2.29 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|