C17H15NO6 — CID 44820134
(6-amino-1,3-benzodioxol-5-yl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 44820134) has the molecular formula C17H15NO6 and a molecular weight of 329.31 g/mol. Its IUPAC name is (6-amino-1,3-benzodioxol-5-yl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | (6-amino-1,3-benzodioxol-5-yl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 44820134 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (6-amino-1,3-benzodioxol-5-yl) (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2cc3c(cc2N)OCO3)ccc1O |
| InChI | InChI=1S/C17H15NO6/c1-21-14-6-10(2-4-12(14)19)3-5-17(20)24-13-8-16-15(7-11(13)18)22-9-23-16/h2-8,19H,9,18H2,1H3/b5-3+ |
| InChIKey | CQCOOEXCEVRXKY-HWKANZROSA-N |
| XLogP | 2.33 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|