C18H14O6 — CID 8001269
methyl 4-[(E)-3-(1,3-benzodioxol-5-yloxy)-3-oxoprop-1-enyl]benzoate (PubChem CID 8001269) has the molecular formula C18H14O6 and a molecular weight of 326.30 g/mol. Its IUPAC name is methyl 4-[(E)-3-(1,3-benzodioxol-5-yloxy)-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-(1,3-benzodioxol-5-yloxy)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 8001269 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | methyl 4-[(E)-3-(1,3-benzodioxol-5-yloxy)-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)Oc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H14O6/c1-21-18(20)13-5-2-12(3-6-13)4-9-17(19)24-14-7-8-15-16(10-14)23-11-22-15/h2-10H,11H2,1H3/b9-4+ |
| InChIKey | VJEOJDOTTBPYDD-RUDMXATFSA-N |
| XLogP | 2.82 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|