C22H16O4 — CID 7926516
(4-phenylphenyl) (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 7926516) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is (4-phenylphenyl) (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (4-phenylphenyl) (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7926516 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (4-phenylphenyl) (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16O4/c23-22(13-7-16-6-12-20-21(14-16)25-15-24-20)26-19-10-8-18(9-11-19)17-4-2-1-3-5-17/h1-14H,15H2/b13-7+ |
| InChIKey | HFEHISPTZVSSFI-NTUHNPAUSA-N |
| XLogP | 4.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|