C23H18O3 — CID 4552324
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-phenylphenyl)prop-2-en-1-one (PubChem CID 4552324) has the molecular formula C23H18O3 and a molecular weight of 342.39 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-phenylphenyl)prop-2-en-1-one.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4552324 |
| Molecular Formula | C23H18O3 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-phenylphenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc2c(c1)OCCO2)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18O3/c24-21(12-6-17-7-13-22-23(16-17)26-15-14-25-22)20-10-8-19(9-11-20)18-4-2-1-3-5-18/h1-13,16H,14-15H2 |
| InChIKey | SDASPEHFPYHBAW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|