C11H11NO3 — CID 169481919
3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide (PubChem CID 169481919) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 169481919 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide |
| SMILES | NC(=O)C=Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H11NO3/c12-11(13)4-2-8-1-3-9-10(7-8)15-6-5-14-9/h1-4,7H,5-6H2,(H2,12,13) |
| InChIKey | MSSSCYXXTVDVRJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|