C13H13ClO3 — CID 77040296
1-chloro-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-3-en-2-one (PubChem CID 77040296) has the molecular formula C13H13ClO3 and a molecular weight of 252.70 g/mol. Its IUPAC name is 1-chloro-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-3-en-2-one.
| Compound Name | 1-chloro-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 77040296 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-chloro-4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-3-en-2-one |
| SMILES | O=C(C=Cc1ccc2c(c1)OCCCO2)CCl |
| InChI | InChI=1S/C13H13ClO3/c14-9-11(15)4-2-10-3-5-12-13(8-10)17-7-1-6-16-12/h2-5,8H,1,6-7,9H2 |
| InChIKey | DTZGGEZNWMXXMK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|