C14H16O3S — CID 169457916
S-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enyl] ethanethioate (PubChem CID 169457916) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is S-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169457916 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | S-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C14H16O3S/c1-11(15)18-9-2-4-12-5-6-13-14(10-12)17-8-3-7-16-13/h2,4-6,10H,3,7-9H2,1H3 |
| InChIKey | OAPOUNWXBLPTAH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|