C13H14OS — CID 169456703
S-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enyl] ethanethioate (PubChem CID 169456703) has the molecular formula C13H14OS and a molecular weight of 218.32 g/mol. Its IUPAC name is S-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169456703 |
| Molecular Formula | C13H14OS |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | S-[3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C13H14OS/c1-10(14)15-8-2-3-11-4-5-12-6-7-13(12)9-11/h2-5,9H,6-8H2,1H3 |
| InChIKey | VIZYRTJVGXTMLA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|