C15H16O2S — CID 169457926
S-[3-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)prop-2-enyl] ethanethioate (PubChem CID 169457926) has the molecular formula C15H16O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is S-[3-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 169457926 |
| Molecular Formula | C15H16O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | S-[3-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC=Cc1ccc2c(c1)CCC(=O)C2 |
| InChI | InChI=1S/C15H16O2S/c1-11(16)18-8-2-3-12-4-5-14-10-15(17)7-6-13(14)9-12/h2-5,9H,6-8,10H2,1H3 |
| InChIKey | QFUZCCOFZAIKFK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|