C14H17NO — CID 170487625
6-(4-aminobut-1-enyl)-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 170487625) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 6-(4-aminobut-1-enyl)-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 6-(4-aminobut-1-enyl)-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 170487625 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 6-(4-aminobut-1-enyl)-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | NCCC=Cc1ccc2c(c1)CCC(=O)C2 |
| InChI | InChI=1S/C14H17NO/c15-8-2-1-3-11-4-5-13-10-14(16)7-6-12(13)9-11/h1,3-5,9H,2,6-8,10,15H2 |
| InChIKey | SLHYMLRMDYHBMH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |