C20H18 — CID 58696689
3-[(1Z,3Z)-4-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)buta-1,3-dienyl]bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 58696689) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-[(1Z,3Z)-4-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)buta-1,3-dienyl]bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 3-[(1Z,3Z)-4-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)buta-1,3-dienyl]bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 58696689 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-[(1Z,3Z)-4-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)buta-1,3-dienyl]bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | C(/C=C\c1ccc2c(c1)CC2)=C/c1ccc2c(c1)CC2 |
| InChI | InChI=1S/C20H18/c1(3-15-5-7-17-9-11-19(17)13-15)2-4-16-6-8-18-10-12-20(18)14-16/h1-8,13-14H,9-12H2/b3-1-,4-2- |
| InChIKey | NJLDJNDTTHMZPB-CCAGOZQPSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|