C13H12O2 — CID 86034884
5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)penta-2,4-dienoic acid (PubChem CID 86034884) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)penta-2,4-dienoic acid.
| Compound Name | 5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 86034884 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)penta-2,4-dienoic acid |
| SMILES | O=C(O)C=CC=Cc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C13H12O2/c14-13(15)4-2-1-3-10-5-6-11-7-8-12(11)9-10/h1-6,9H,7-8H2,(H,14,15) |
| InChIKey | WRTADSMPQGCECL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|