C17H16O3 — CID 91104661
11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid (PubChem CID 91104661) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid.
| Compound Name | 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid |
|---|---|
| PubChem CID | 91104661 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid |
| SMILES | O=C(O)C=CC=CC=CC=CC=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C17H16O3/c18-16-13-11-15(12-14-16)9-7-5-3-1-2-4-6-8-10-17(19)20/h1-14,18H,(H,19,20) |
| InChIKey | XAOZSALWBPQKOA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|