11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid

C17H16O3 — CID 91104661

IUPAC11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid
SMILESO=C(O)C=CC=CC=CC=CC=Cc1ccc(O)cc1
InChIInChI=1S/C17H16O3/c18-16-13-11-15(12-14-16)9-7-5-3-1-2-4-6-8-10-17(19)20/h1-14,18H,(H,19,20)
InChIKeyXAOZSALWBPQKOA-UHFFFAOYSA-N
MW268.31 g/mol
LogP3.71
Rot. Bonds6

About 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid

11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid (PubChem CID 91104661) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid.

Molecular Properties

Compound Name11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid
PubChem CID91104661
Molecular FormulaC17H16O3
Molecular Weight268.31 g/mol
Exact Mass268.11
IUPAC Name11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid
SMILESO=C(O)C=CC=CC=CC=CC=Cc1ccc(O)cc1
InChIInChI=1S/C17H16O3/c18-16-13-11-15(12-14-16)9-7-5-3-1-2-4-6-8-10-17(19)20/h1-14,18H,(H,19,20)
InChIKeyXAOZSALWBPQKOA-UHFFFAOYSA-N
XLogP3.71
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 53.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid?
The IUPAC name of 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid (CID 91104661) is 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid.
What is the SMILES notation for 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid?
The canonical SMILES for 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid is O=C(O)C=CC=CC=CC=CC=Cc1ccc(O)cc1.
What is the InChIKey of 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid?
The InChIKey is XAOZSALWBPQKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c18-16-13-11-15(12-14-16)9-7-5-3-1-2-4-6-8-10-17(19)20/h1-14,18H,(H,19,20).
What are the key properties of 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid?
11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid has a molecular weight of 268.31 g/mol, XLogP of 3.71, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-(4-hydroxyphenyl)undeca-2,4,6,8,10-pentaenoic acid is sourced from PubChem (CID 91104661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).