C11H10O4 — CID 170990383
(2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid (PubChem CID 170990383) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid.
| Compound Name | (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 170990383 |
| Molecular Formula | C11H10O4 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid |
| SMILES | O=C(O)/C=C/C=C\c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H10O4/c12-9-5-8(6-10(13)7-9)3-1-2-4-11(14)15/h1-7,12-13H,(H,14,15)/b3-1-,4-2+ |
| InChIKey | XHUWKYOSLGQGIH-HSFFGMMNSA-N |
| XLogP | 1.75 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|