(2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid

C11H10O4 — CID 170990383

IUPAC(2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid
SMILESO=C(O)/C=C/C=C\c1cc(O)cc(O)c1
InChIInChI=1S/C11H10O4/c12-9-5-8(6-10(13)7-9)3-1-2-4-11(14)15/h1-7,12-13H,(H,14,15)/b3-1-,4-2+
InChIKeyXHUWKYOSLGQGIH-HSFFGMMNSA-N
MW206.20 g/mol
LogP1.75
Rot. Bonds3

About (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid

(2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid (PubChem CID 170990383) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid
PubChem CID170990383
Molecular FormulaC11H10O4
Molecular Weight206.20 g/mol
Exact Mass206.06
IUPAC Name(2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid
SMILESO=C(O)/C=C/C=C\c1cc(O)cc(O)c1
InChIInChI=1S/C11H10O4/c12-9-5-8(6-10(13)7-9)3-1-2-4-11(14)15/h1-7,12-13H,(H,14,15)/b3-1-,4-2+
InChIKeyXHUWKYOSLGQGIH-HSFFGMMNSA-N
XLogP1.75
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.20
LogP ≤ 51.75
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid?
The IUPAC name of (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid (CID 170990383) is (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid.
What is the SMILES notation for (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid?
The canonical SMILES for (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid is O=C(O)/C=C/C=C\c1cc(O)cc(O)c1.
What is the InChIKey of (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid?
The InChIKey is XHUWKYOSLGQGIH-HSFFGMMNSA-N. The full InChI is InChI=1S/C11H10O4/c12-9-5-8(6-10(13)7-9)3-1-2-4-11(14)15/h1-7,12-13H,(H,14,15)/b3-1-,4-2+.
What are the key properties of (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid?
(2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid has a molecular weight of 206.20 g/mol, XLogP of 1.75, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-5-(3,5-dihydroxyphenyl)penta-2,4-dienoic acid is sourced from PubChem (CID 170990383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).