C34H42O5 — CID 25189638
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;(2E,4E,6E,8E,10E)-icosa-2,4,6,8,10-pentaenoic acid (PubChem CID 25189638) has the molecular formula C34H42O5 and a molecular weight of 530.71 g/mol. Its IUPAC name is 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;(2E,4E,6E,8E,10E)-icosa-2,4,6,8,10-pentaenoic acid.
| Compound Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;(2E,4E,6E,8E,10E)-icosa-2,4,6,8,10-pentaenoic acid |
|---|---|
| PubChem CID | 25189638 |
| Molecular Formula | C34H42O5 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;(2E,4E,6E,8E,10E)-icosa-2,4,6,8,10-pentaenoic acid |
| SMILES | CCCCCCCCC/C=C/C=C/C=C/C=C/C=C/C(=O)O.Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C20H30O2.C14H12O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22;15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h10-19H,2-9H2,1H3,(H,21,22);1-9,15-17H/b11-10+,13-12+,15-14+,17-16+,19-18+;2-1+ |
| InChIKey | GFNNJUOMFZJBDR-UZUHLTMKSA-N |
| XLogP | 8.97 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|