3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid

C11H10O2 — CID 71362115

IUPAC3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid
SMILESO=C(O)C=Cc1ccc2c(c1)CC2
InChIInChI=1S/C11H10O2/c12-11(13)6-2-8-1-3-9-4-5-10(9)7-8/h1-3,6-7H,4-5H2,(H,12,13)
InChIKeyIZCTXTLRNULVRN-UHFFFAOYSA-N
MW174.20 g/mol
LogP1.88
Rot. Bonds2

About 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid

3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid (PubChem CID 71362115) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid.

Molecular Properties

Compound Name3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid
PubChem CID71362115
Molecular FormulaC11H10O2
Molecular Weight174.20 g/mol
Exact Mass174.07
IUPAC Name3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid
SMILESO=C(O)C=Cc1ccc2c(c1)CC2
InChIInChI=1S/C11H10O2/c12-11(13)6-2-8-1-3-9-4-5-10(9)7-8/h1-3,6-7H,4-5H2,(H,12,13)
InChIKeyIZCTXTLRNULVRN-UHFFFAOYSA-N
XLogP1.88
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.20
LogP ≤ 51.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid?
The IUPAC name of 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid (CID 71362115) is 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid.
What is the SMILES notation for 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid?
The canonical SMILES for 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid is O=C(O)C=Cc1ccc2c(c1)CC2.
What is the InChIKey of 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid?
The InChIKey is IZCTXTLRNULVRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2/c12-11(13)6-2-8-1-3-9-4-5-10(9)7-8/h1-3,6-7H,4-5H2,(H,12,13).
What are the key properties of 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid?
3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid has a molecular weight of 174.20 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid is sourced from PubChem (CID 71362115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).