C11H10O2 — CID 71362115
3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid (PubChem CID 71362115) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid.
| Compound Name | 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 71362115 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc2c(c1)CC2 |
| InChI | InChI=1S/C11H10O2/c12-11(13)6-2-8-1-3-9-4-5-10(9)7-8/h1-3,6-7H,4-5H2,(H,12,13) |
| InChIKey | IZCTXTLRNULVRN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|