C17H13BrO2 — CID 54226323
3-(7-bromo-9,10-dihydrophenanthren-2-yl)prop-2-enoic acid (PubChem CID 54226323) has the molecular formula C17H13BrO2 and a molecular weight of 329.19 g/mol. Its IUPAC name is 3-(7-bromo-9,10-dihydrophenanthren-2-yl)prop-2-enoic acid.
| Compound Name | 3-(7-bromo-9,10-dihydrophenanthren-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54226323 |
| Molecular Formula | C17H13BrO2 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 3-(7-bromo-9,10-dihydrophenanthren-2-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc2c(c1)CCc1cc(Br)ccc1-2 |
| InChI | InChI=1S/C17H13BrO2/c18-14-5-7-16-13(10-14)4-3-12-9-11(1-6-15(12)16)2-8-17(19)20/h1-2,5-10H,3-4H2,(H,19,20) |
| InChIKey | QGCKYGSGHXJZIK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|