C16H13BrO3 — CID 67764551
3-(3-bromophenyl)prop-2-enoic acid;7-oxabicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 67764551) has the molecular formula C16H13BrO3 and a molecular weight of 333.18 g/mol. Its IUPAC name is 3-(3-bromophenyl)prop-2-enoic acid;7-oxabicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 3-(3-bromophenyl)prop-2-enoic acid;7-oxabicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 67764551 |
| Molecular Formula | C16H13BrO3 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 3-(3-bromophenyl)prop-2-enoic acid;7-oxabicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | O=C(O)C=Cc1cccc(Br)c1.c1ccc2c(c1)CO2 |
| InChI | InChI=1S/C9H7BrO2.C7H6O/c10-8-3-1-2-7(6-8)4-5-9(11)12;1-2-4-7-6(3-1)5-8-7/h1-6H,(H,11,12);1-4H,5H2 |
| InChIKey | CILKTXFDUPEWES-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|