C17H14BrNO — CID 5139349
3-(3-bromophenyl)-1-(2,3-dihydroindol-1-yl)prop-2-en-1-one (PubChem CID 5139349) has the molecular formula C17H14BrNO and a molecular weight of 328.21 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-(2,3-dihydroindol-1-yl)prop-2-en-1-one.
| Compound Name | 3-(3-bromophenyl)-1-(2,3-dihydroindol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5139349 |
| Molecular Formula | C17H14BrNO |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 3-(3-bromophenyl)-1-(2,3-dihydroindol-1-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc(Br)c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H14BrNO/c18-15-6-3-4-13(12-15)8-9-17(20)19-11-10-14-5-1-2-7-16(14)19/h1-9,12H,10-11H2 |
| InChIKey | MOLIHBHXDOHTHG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|