C19H18BrNO — CID 7919830
(E)-3-(3-bromophenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide (PubChem CID 7919830) has the molecular formula C19H18BrNO and a molecular weight of 356.26 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 7919830 |
| Molecular Formula | C19H18BrNO |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Br)c1)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C19H18BrNO/c20-16-8-3-5-14(13-16)11-12-19(22)21-18-10-4-7-15-6-1-2-9-17(15)18/h1-3,5-6,8-9,11-13,18H,4,7,10H2,(H,21,22)/b12-11+/t18-/m0/s1 |
| InChIKey | CZTQPLOSXLKJBZ-DXRVJIQQSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|