C21H22N2O3 — CID 134030162
(E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)prop-2-enamide (PubChem CID 134030162) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 134030162 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)prop-2-enamide |
| SMILES | NC(=O)COc1ccc(/C=C/C(=O)NC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H22N2O3/c22-20(24)14-26-17-11-8-15(9-12-17)10-13-21(25)23-19-7-3-5-16-4-1-2-6-18(16)19/h1-2,4,6,8-13,19H,3,5,7,14H2,(H2,22,24)(H,23,25)/b13-10+ |
| InChIKey | ISYHSTYCTMFEGZ-JLHYYAGUSA-N |
| XLogP | 2.76 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|